C17H22ClFN6 — CID 171839462
2-[1-(2-chloro-5-methylpyrimidin-4-yl)-3-(7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)azetidin-3-yl]acetonitrile (PubChem CID 171839462) has the molecular formula C17H22ClFN6 and a molecular weight of 364.86 g/mol. Its IUPAC name is 2-[1-(2-chloro-5-methylpyrimidin-4-yl)-3-(7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-(2-chloro-5-methylpyrimidin-4-yl)-3-(7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 171839462 |
| Molecular Formula | C17H22ClFN6 |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[1-(2-chloro-5-methylpyrimidin-4-yl)-3-(7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)azetidin-3-yl]acetonitrile |
| SMILES | Cc1cnc(Cl)nc1N1CC(CC#N)(N2CCN3CC(F)CC3C2)C1 |
| InChI | InChI=1S/C17H22ClFN6/c1-12-7-21-16(18)22-15(12)24-10-17(11-24,2-3-20)25-5-4-23-8-13(19)6-14(23)9-25/h7,13-14H,2,4-6,8-11H2,1H3 |
| InChIKey | YXKYOUMTBJWHHE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |