About (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide
(NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 171839499) has the molecular formula C13H15BrFNOS
and a molecular weight of 332.24 g/mol. Its IUPAC name is (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide |
| PubChem CID | 171839499 |
| Molecular Formula | C13H15BrFNOS |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C1\CCc2cc(Br)cc(F)c21 |
| InChI | InChI=1S/C13H15BrFNOS/c1-13(2,3)18(17)16-11-5-4-8-6-9(14)7-10(15)12(8)11/h6-7H,4-5H2,1-3H3/b16-11+/t18-/m0/s1 |
| InChIKey | VQPNNZNVCPLOCA-FYXHJSOBSA-N |
| XLogP | 3.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
The IUPAC name of (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide (CID 171839499) is (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide is CC(C)(C)[S@](=O)/N=C1\CCc2cc(Br)cc(F)c21.
What is the InChIKey of (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
The InChIKey is VQPNNZNVCPLOCA-FYXHJSOBSA-N. The full InChI is InChI=1S/C13H15BrFNOS/c1-13(2,3)18(17)16-11-5-4-8-6-9(14)7-10(15)12(8)11/h6-7H,4-5H2,1-3H3/b16-11+/t18-/m0/s1.
What are the key properties of (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
(NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide has a molecular weight of 332.24 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NE,S)-N-(5-bromo-7-fluoro-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 171839499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).