About [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite
[2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite (PubChem CID 171840157) has the molecular formula C7H16FIN2S2
and a molecular weight of 338.26 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite.
Molecular Properties
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite |
| PubChem CID | 171840157 |
| Molecular Formula | C7H16FIN2S2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite |
| SMILES | CSF.NCC1CCCN1CSI |
| InChI | InChI=1S/C6H13IN2S.CH3FS/c7-10-5-9-3-1-2-6(9)4-8;1-3-2/h6H,1-5,8H2;1H3 |
| InChIKey | MLASNQYURWTSMG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite?
The IUPAC name of [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite (CID 171840157) is [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite.
What is the SMILES notation for [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite?
The canonical SMILES for [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite is CSF.NCC1CCCN1CSI.
What is the InChIKey of [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite?
The InChIKey is MLASNQYURWTSMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13IN2S.CH3FS/c7-10-5-9-3-1-2-6(9)4-8;1-3-2/h6H,1-5,8H2;1H3.
What are the key properties of [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite?
[2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite has a molecular weight of 338.26 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)pyrrolidin-1-yl]methyl thiohypoiodite;methyl thiohypofluorite is sourced from PubChem (CID 171840157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).