C21H33N2+ — CID 171840878
(2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-7-(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)hepta-2,4,6-trienylidene]pyrrolidine (PubChem CID 171840878) has the molecular formula C21H33N2+ and a molecular weight of 313.51 g/mol. Its IUPAC name is (2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-7-(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)hepta-2,4,6-trienylidene]pyrrolidine.
| Compound Name | (2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-7-(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)hepta-2,4,6-trienylidene]pyrrolidine |
|---|---|
| PubChem CID | 171840878 |
| Molecular Formula | C21H33N2+ |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | (2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-7-(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)hepta-2,4,6-trienylidene]pyrrolidine |
| SMILES | CN1CCC(C)(C)/C1=C\C=C\C=C\C=C\C1=[N+](C)CCC1(C)C |
| InChI | InChI=1S/C21H33N2/c1-20(2)14-16-22(5)18(20)12-10-8-7-9-11-13-19-21(3,4)15-17-23(19)6/h7-13H,14-17H2,1-6H3/q+1 |
| InChIKey | KERPJQKAATUFDL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|