About 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate
3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate (PubChem CID 171841202) has the molecular formula C24H34N2O2S
and a molecular weight of 414.62 g/mol. Its IUPAC name is 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate.
Molecular Properties
| Compound Name | 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate |
| PubChem CID | 171841202 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C)cc2)cc1C.CCCC.CSC(N)CC#N |
| InChI | InChI=1S/C16H16O2.C4H8N2S.C4H10/c1-11-4-6-14(7-5-11)15-8-9-16(12(2)10-15)18-13(3)17;1-7-4(6)2-3-5;1-3-4-2/h4-10H,1-3H3;4H,2,6H2,1H3;3-4H2,1-2H3 |
| InChIKey | ABXVBYQUKVEVGG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate?
The IUPAC name of 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate (CID 171841202) is 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate.
What is the SMILES notation for 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate?
The canonical SMILES for 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate is CC(=O)Oc1ccc(-c2ccc(C)cc2)cc1C.CCCC.CSC(N)CC#N.
What is the InChIKey of 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate?
The InChIKey is ABXVBYQUKVEVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2.C4H8N2S.C4H10/c1-11-4-6-14(7-5-11)15-8-9-16(12(2)10-15)18-13(3)17;1-7-4(6)2-3-5;1-3-4-2/h4-10H,1-3H3;4H,2,6H2,1H3;3-4H2,1-2H3.
What are the key properties of 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate?
3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate has a molecular weight of 414.62 g/mol, XLogP of 6.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-methylsulfanylpropanenitrile;butane;[2-methyl-4-(4-methylphenyl)phenyl] acetate is sourced from PubChem (CID 171841202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).