C12H23N3O3 — CID 171841464
1-acetyl-N-methyl-4-(3-methyloxiran-2-yl)-1,4-diazepane-6-carboxamide;molecular hydrogen (PubChem CID 171841464) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-acetyl-N-methyl-4-(3-methyloxiran-2-yl)-1,4-diazepane-6-carboxamide;molecular hydrogen.
| Compound Name | 1-acetyl-N-methyl-4-(3-methyloxiran-2-yl)-1,4-diazepane-6-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 171841464 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 1-acetyl-N-methyl-4-(3-methyloxiran-2-yl)-1,4-diazepane-6-carboxamide;molecular hydrogen |
| SMILES | CNC(=O)C1CN(C(C)=O)CCN(C2OC2C)C1.[H][H] |
| InChI | InChI=1S/C12H21N3O3.H2/c1-8-12(18-8)15-5-4-14(9(2)16)6-10(7-15)11(17)13-3;/h8,10,12H,4-7H2,1-3H3,(H,13,17);1H |
| InChIKey | OGRXOKHQVRJCRM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|