C27H44N4O5 — CID 171841582
N-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide;2,2,4,4-tetramethylhexane (PubChem CID 171841582) has the molecular formula C27H44N4O5 and a molecular weight of 504.67 g/mol. Its IUPAC name is N-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide;2,2,4,4-tetramethylhexane.
| Compound Name | N-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide;2,2,4,4-tetramethylhexane |
|---|---|
| PubChem CID | 171841582 |
| Molecular Formula | C27H44N4O5 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | N-[2-[2-(2-formamidoethoxy)ethoxy]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide;2,2,4,4-tetramethylhexane |
| SMILES | CCC(C)(C)CC(C)(C)C.Cc1nnc(-c2ccc(C(=O)NCCOCCOCCNC=O)cc2)o1 |
| InChI | InChI=1S/C17H22N4O5.C10H22/c1-13-20-21-17(26-13)15-4-2-14(3-5-15)16(23)19-7-9-25-11-10-24-8-6-18-12-22;1-7-10(5,6)8-9(2,3)4/h2-5,12H,6-11H2,1H3,(H,18,22)(H,19,23);7-8H2,1-6H3 |
| InChIKey | QLWDKBQVORWQKK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|