C34H59NO7 — CID 171841657
(5Z,8Z,11Z,14Z)-N-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]icosa-5,8,11,14-tetraenamide (PubChem CID 171841657) has the molecular formula C34H59NO7 and a molecular weight of 593.85 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 171841657 |
| Molecular Formula | C34H59NO7 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.43 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOCCOCCOCCOCCOCCC(C)=O |
| InChI | InChI=1S/C34H59NO7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-34(37)35-22-24-39-26-28-41-30-32-42-31-29-40-27-25-38-23-21-33(2)36/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-32H2,1-2H3,(H,35,37)/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | LEUMMGBXHAHCSW-ZKWNWVNESA-N |
| XLogP | 6.31 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|