About 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole
4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole (PubChem CID 171842001) has the molecular formula C12H12BrF2N3
and a molecular weight of 316.15 g/mol. Its IUPAC name is 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole |
| PubChem CID | 171842001 |
| Molecular Formula | C12H12BrF2N3 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole |
| SMILES | FC1(F)CCN(c2nc3c(Br)cccc3[nH]2)CC1 |
| InChI | InChI=1S/C12H12BrF2N3/c13-8-2-1-3-9-10(8)17-11(16-9)18-6-4-12(14,15)5-7-18/h1-3H,4-7H2,(H,16,17) |
| InChIKey | BBAORGXXBHSAJO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole?
The IUPAC name of 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole (CID 171842001) is 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole.
What is the SMILES notation for 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole?
The canonical SMILES for 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole is FC1(F)CCN(c2nc3c(Br)cccc3[nH]2)CC1.
What is the InChIKey of 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole?
The InChIKey is BBAORGXXBHSAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrF2N3/c13-8-2-1-3-9-10(8)17-11(16-9)18-6-4-12(14,15)5-7-18/h1-3H,4-7H2,(H,16,17).
What are the key properties of 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole?
4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole has a molecular weight of 316.15 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(4,4-difluoropiperidin-1-yl)-1H-benzimidazole is sourced from PubChem (CID 171842001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).