C17H12Cl2FNO2 — CID 171842264
methyl 3-[(5,6-dichloroindol-1-yl)methyl]-2-fluorobenzoate (PubChem CID 171842264) has the molecular formula C17H12Cl2FNO2 and a molecular weight of 352.19 g/mol. Its IUPAC name is methyl 3-[(5,6-dichloroindol-1-yl)methyl]-2-fluorobenzoate.
| Compound Name | methyl 3-[(5,6-dichloroindol-1-yl)methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 171842264 |
| Molecular Formula | C17H12Cl2FNO2 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | methyl 3-[(5,6-dichloroindol-1-yl)methyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cccc(Cn2ccc3cc(Cl)c(Cl)cc32)c1F |
| InChI | InChI=1S/C17H12Cl2FNO2/c1-23-17(22)12-4-2-3-11(16(12)20)9-21-6-5-10-7-13(18)14(19)8-15(10)21/h2-8H,9H2,1H3 |
| InChIKey | SIPDCNLJTPUJBN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |