C32H36N4O3 — CID 171842661
2-N,3-N,3-N-tris[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2,3-diamine (PubChem CID 171842661) has the molecular formula C32H36N4O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-N,3-N,3-N-tris[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2,3-diamine.
| Compound Name | 2-N,3-N,3-N-tris[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2,3-diamine |
|---|---|
| PubChem CID | 171842661 |
| Molecular Formula | C32H36N4O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 2-N,3-N,3-N-tris[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2,3-diamine |
| SMILES | COc1ccc(CNc2nc3c(cc2N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)CNCC3)cc1 |
| InChI | InChI=1S/C32H36N4O3/c1-37-27-10-4-23(5-11-27)19-34-32-31(18-26-20-33-17-16-30(26)35-32)36(21-24-6-12-28(38-2)13-7-24)22-25-8-14-29(39-3)15-9-25/h4-15,18,33H,16-17,19-22H2,1-3H3,(H,34,35) |
| InChIKey | WPSPYPCHNSYVBP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 67.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |