About 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol
2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol (PubChem CID 171842845) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol |
| PubChem CID | 171842845 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1CNC[C@H](C(C)(C)O)C1 |
| InChI | InChI=1S/C11H23NO2/c1-10(2,13)8-5-9(7-12-6-8)11(3,4)14/h8-9,12-14H,5-7H2,1-4H3/t8-,9+ |
| InChIKey | XMVIRGSGLIPPJX-DTORHVGOSA-N |
| XLogP | 0.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol?
The IUPAC name of 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol (CID 171842845) is 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol.
What is the SMILES notation for 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol?
The canonical SMILES for 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol is CC(C)(O)[C@@H]1CNC[C@H](C(C)(C)O)C1.
What is the InChIKey of 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol?
The InChIKey is XMVIRGSGLIPPJX-DTORHVGOSA-N. The full InChI is InChI=1S/C11H23NO2/c1-10(2,13)8-5-9(7-12-6-8)11(3,4)14/h8-9,12-14H,5-7H2,1-4H3/t8-,9+.
What are the key properties of 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol?
2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol has a molecular weight of 201.31 g/mol, XLogP of 0.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,5R)-5-(2-hydroxypropan-2-yl)piperidin-3-yl]propan-2-ol is sourced from PubChem (CID 171842845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).