About (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one
(5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one (PubChem CID 171842990) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one |
| PubChem CID | 171842990 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one |
| SMILES | CN1C[C@](C)([C@H]2CCCNC2)OC1=O |
| InChI | InChI=1S/C10H18N2O2/c1-10(7-12(2)9(13)14-10)8-4-3-5-11-6-8/h8,11H,3-7H2,1-2H3/t8-,10+/m0/s1 |
| InChIKey | ISFQXOKJWDKHSN-WCBMZHEXSA-N |
| XLogP | 0.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one?
The IUPAC name of (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one (CID 171842990) is (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one?
The canonical SMILES for (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one is CN1C[C@](C)([C@H]2CCCNC2)OC1=O.
What is the InChIKey of (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one?
The InChIKey is ISFQXOKJWDKHSN-WCBMZHEXSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-10(7-12(2)9(13)14-10)8-4-3-5-11-6-8/h8,11H,3-7H2,1-2H3/t8-,10+/m0/s1.
What are the key properties of (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one?
(5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one has a molecular weight of 198.27 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,5-dimethyl-5-[(3S)-piperidin-3-yl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 171842990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).