ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate

C14H28N2O3 — CID 171843387

IUPACethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate
SMILESCC.CC(C)OC(=O)CCC(=O)N1CCN(C)CC1
InChIInChI=1S/C12H22N2O3.C2H6/c1-10(2)17-12(16)5-4-11(15)14-8-6-13(3)7-9-14;1-2/h10H,4-9H2,1-3H3;1-2H3
InChIKeyMONOVODGIUITGG-UHFFFAOYSA-N
MW272.39 g/mol
LogP1.52
Rot. Bonds4

About ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate

ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate (PubChem CID 171843387) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate.

Molecular Properties

Compound Nameethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate
PubChem CID171843387
Molecular FormulaC14H28N2O3
Molecular Weight272.39 g/mol
Exact Mass272.21
IUPAC Nameethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate
SMILESCC.CC(C)OC(=O)CCC(=O)N1CCN(C)CC1
InChIInChI=1S/C12H22N2O3.C2H6/c1-10(2)17-12(16)5-4-11(15)14-8-6-13(3)7-9-14;1-2/h10H,4-9H2,1-3H3;1-2H3
InChIKeyMONOVODGIUITGG-UHFFFAOYSA-N
XLogP1.52
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.39
LogP ≤ 51.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate?
The IUPAC name of ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate (CID 171843387) is ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate.
What is the SMILES notation for ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate?
The canonical SMILES for ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate is CC.CC(C)OC(=O)CCC(=O)N1CCN(C)CC1.
What is the InChIKey of ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate?
The InChIKey is MONOVODGIUITGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3.C2H6/c1-10(2)17-12(16)5-4-11(15)14-8-6-13(3)7-9-14;1-2/h10H,4-9H2,1-3H3;1-2H3.
What are the key properties of ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate?
ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate has a molecular weight of 272.39 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 4-(4-methylpiperazin-1-yl)-4-oxobutanoate is sourced from PubChem (CID 171843387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).