C16H27NO — CID 171843553
[[(2R,4Z,5Z,8Z,10Z)-4-ethylidene-7-methyldodeca-5,8,10-trien-2-yl]amino]methanol (PubChem CID 171843553) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is [[(2R,4Z,5Z,8Z,10Z)-4-ethylidene-7-methyldodeca-5,8,10-trien-2-yl]amino]methanol.
| Compound Name | [[(2R,4Z,5Z,8Z,10Z)-4-ethylidene-7-methyldodeca-5,8,10-trien-2-yl]amino]methanol |
|---|---|
| PubChem CID | 171843553 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | [[(2R,4Z,5Z,8Z,10Z)-4-ethylidene-7-methyldodeca-5,8,10-trien-2-yl]amino]methanol |
| SMILES | C/C=C\C=C/C(C)/C=C\C(=C/C)C[C@@H](C)NCO |
| InChI | InChI=1S/C16H27NO/c1-5-7-8-9-14(3)10-11-16(6-2)12-15(4)17-13-18/h5-11,14-15,17-18H,12-13H2,1-4H3/b7-5-,9-8-,11-10-,16-6+/t14?,15-/m1/s1 |
| InChIKey | VUETVGJBROBPJC-KDKCTNPBSA-N |
| XLogP | 3.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|