About tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate
tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate (PubChem CID 171844097) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate |
| PubChem CID | 171844097 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC=CC(=O)NC2=O)C1 |
| InChI | InChI=1S/C14H20N2O4/c1-13(2,3)20-12(19)16-8-7-14(9-16)6-4-5-10(17)15-11(14)18/h4-5H,6-9H2,1-3H3,(H,15,17,18) |
| InChIKey | QSTFRRLPYMVUJD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate?
The IUPAC name of tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate (CID 171844097) is tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate.
What is the SMILES notation for tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate?
The canonical SMILES for tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate is CC(C)(C)OC(=O)N1CCC2(CC=CC(=O)NC2=O)C1.
What is the InChIKey of tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate?
The InChIKey is QSTFRRLPYMVUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-13(2,3)20-12(19)16-8-7-14(9-16)6-4-5-10(17)15-11(14)18/h4-5H,6-9H2,1-3H3,(H,15,17,18).
What are the key properties of tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate?
tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate has a molecular weight of 280.32 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6,8-dioxo-2,7-diazaspiro[4.6]undec-9-ene-2-carboxylate is sourced from PubChem (CID 171844097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).