C21H23ClN6O — CID 171844255
4-[[(10-chlorospiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-yl)amino]methyl]benzamide (PubChem CID 171844255) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-[[(10-chlorospiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-yl)amino]methyl]benzamide.
| Compound Name | 4-[[(10-chlorospiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 171844255 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[[(10-chlorospiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-yl)amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNc2c3c(nc4c(Cl)cnn24)C2(CCNCC2)CC3)cc1 |
| InChI | InChI=1S/C21H23ClN6O/c22-16-12-26-28-19(25-11-13-1-3-14(4-2-13)18(23)29)15-5-6-21(7-9-24-10-8-21)17(15)27-20(16)28/h1-4,12,24-25H,5-11H2,(H2,23,29) |
| InChIKey | JXHWJYTUOSIXAN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |