C19H27N5 — CID 171844266
N-[(1S,3S)-3-(aminomethyl)cyclopentyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine (PubChem CID 171844266) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[(1S,3S)-3-(aminomethyl)cyclopentyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine.
| Compound Name | N-[(1S,3S)-3-(aminomethyl)cyclopentyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine |
|---|---|
| PubChem CID | 171844266 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | N-[(1S,3S)-3-(aminomethyl)cyclopentyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine |
| SMILES | NC[C@H]1CC[C@H](Nc2c3c(nc4ccnn24)C2(CCCC2)CC3)C1 |
| InChI | InChI=1S/C19H27N5/c20-12-13-3-4-14(11-13)22-18-15-5-9-19(7-1-2-8-19)17(15)23-16-6-10-21-24(16)18/h6,10,13-14,22H,1-5,7-9,11-12,20H2/t13-,14-/m0/s1 |
| InChIKey | VCPZMBCKOMQGHO-KBPBESRZSA-N |
| XLogP | 3.03 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |