C18H26N6 — CID 171844298
trans-(1S,3S)-3-N-spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-ylcyclopentane-1,3-diamine (PubChem CID 171844298) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is trans-(1S,3S)-3-N-spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-ylcyclopentane-1,3-diamine.
| Compound Name | trans-(1S,3S)-3-N-spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-ylcyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 171844298 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | trans-(1S,3S)-3-N-spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-ylcyclopentane-1,3-diamine |
| SMILES | N[C@H]1CC[C@H](Nc2c3c(nc4ccnn24)C2(CCNCC2)CC3)C1 |
| InChI | InChI=1S/C18H26N6/c19-12-1-2-13(11-12)22-17-14-3-5-18(6-9-20-10-7-18)16(14)23-15-4-8-21-24(15)17/h4,8,12-13,20,22H,1-3,5-7,9-11,19H2/t12-,13-/m0/s1 |
| InChIKey | FYOXEPLASRDKGQ-STQMWFEESA-N |
| XLogP | 1.59 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |