C20H22BrN5O — CID 171844478
10-bromo-N-[(1-oxidopyridin-1-ium-3-yl)methyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclohexane]-2-amine (PubChem CID 171844478) has the molecular formula C20H22BrN5O and a molecular weight of 428.33 g/mol. Its IUPAC name is 10-bromo-N-[(1-oxidopyridin-1-ium-3-yl)methyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclohexane]-2-amine.
| Compound Name | 10-bromo-N-[(1-oxidopyridin-1-ium-3-yl)methyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclohexane]-2-amine |
|---|---|
| PubChem CID | 171844478 |
| Molecular Formula | C20H22BrN5O |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 10-bromo-N-[(1-oxidopyridin-1-ium-3-yl)methyl]spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclohexane]-2-amine |
| SMILES | [O-][n+]1cccc(CNc2c3c(nc4c(Br)cnn24)C2(CCCCC2)CC3)c1 |
| InChI | InChI=1S/C20H22BrN5O/c21-16-12-23-26-18(22-11-14-5-4-10-25(27)13-14)15-6-9-20(7-2-1-3-8-20)17(15)24-19(16)26/h4-5,10,12-13,22H,1-3,6-9,11H2 |
| InChIKey | ZDIFTIDRDOVXRA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|