C36H32 — CID 171844791
2-methyl-9-[(3R,4E,6Z)-3-methyldeca-1,4,6,9-tetraen-5-yl]-10-naphthalen-2-ylanthracene (PubChem CID 171844791) has the molecular formula C36H32 and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-methyl-9-[(3R,4E,6Z)-3-methyldeca-1,4,6,9-tetraen-5-yl]-10-naphthalen-2-ylanthracene.
| Compound Name | 2-methyl-9-[(3R,4E,6Z)-3-methyldeca-1,4,6,9-tetraen-5-yl]-10-naphthalen-2-ylanthracene |
|---|---|
| PubChem CID | 171844791 |
| Molecular Formula | C36H32 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-methyl-9-[(3R,4E,6Z)-3-methyldeca-1,4,6,9-tetraen-5-yl]-10-naphthalen-2-ylanthracene |
| SMILES | C=CC/C=C\C(=C/[C@H](C)C=C)c1c2ccccc2c(-c2ccc3ccccc3c2)c2ccc(C)cc12 |
| InChI | InChI=1S/C36H32/c1-5-7-8-15-29(22-25(3)6-2)36-32-17-12-11-16-31(32)35(33-21-18-26(4)23-34(33)36)30-20-19-27-13-9-10-14-28(27)24-30/h5-6,8-25H,1-2,7H2,3-4H3/b15-8-,29-22+/t25-/m1/s1 |
| InChIKey | QFIVNLZULGUWJM-GSVNTNDMSA-N |
| XLogP | 10.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|