C38H22N4O2S — CID 171844937
4-[4-(12-phenylindolo[3,2-c]carbazol-5-yl)phenyl]sulfonylbenzene-1,3-dicarbonitrile (PubChem CID 171844937) has the molecular formula C38H22N4O2S and a molecular weight of 598.69 g/mol. Its IUPAC name is 4-[4-(12-phenylindolo[3,2-c]carbazol-5-yl)phenyl]sulfonylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-[4-(12-phenylindolo[3,2-c]carbazol-5-yl)phenyl]sulfonylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 171844937 |
| Molecular Formula | C38H22N4O2S |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 4-[4-(12-phenylindolo[3,2-c]carbazol-5-yl)phenyl]sulfonylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)c2ccc(-n3c4ccccc4c4c3ccc3c5ccccc5n(-c5ccccc5)c34)cc2)c(C#N)c1 |
| InChI | InChI=1S/C38H22N4O2S/c39-23-25-14-21-36(26(22-25)24-40)45(43,44)29-17-15-28(16-18-29)41-34-13-7-5-11-32(34)37-35(41)20-19-31-30-10-4-6-12-33(30)42(38(31)37)27-8-2-1-3-9-27/h1-22H |
| InChIKey | AUGJSYROAYKTGW-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 91.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |