C15H17F2N3O3 — CID 171846809
4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,3-difluorocyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 171846809) has the molecular formula C15H17F2N3O3 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,3-difluorocyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,3-difluorocyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 171846809 |
| Molecular Formula | C15H17F2N3O3 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,3-difluorocyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | CN(C)C1=C(F)C(F)=C(C(=O)NC2CCC(=O)NC2=O)C=CC1 |
| InChI | InChI=1S/C15H17F2N3O3/c1-20(2)10-5-3-4-8(12(16)13(10)17)14(22)18-9-6-7-11(21)19-15(9)23/h3-4,9H,5-7H2,1-2H3,(H,18,22)(H,19,21,23) |
| InChIKey | ACDKTIVWADYXAW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|