C15H18FN3O3 — CID 171847068
4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluorocyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 171847068) has the molecular formula C15H18FN3O3 and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluorocyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluorocyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 171847068 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluorocyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | CN(C)C1=CC=C(C(=O)NC2CCC(=O)NC2=O)C=CC1F |
| InChI | InChI=1S/C15H18FN3O3/c1-19(2)12-7-4-9(3-5-10(12)16)14(21)17-11-6-8-13(20)18-15(11)22/h3-5,7,10-11H,6,8H2,1-2H3,(H,17,21)(H,18,20,22) |
| InChIKey | AQTSEZKERATUBG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|