About cyclobutanol;(4S)-3,3,4-trimethylpiperidine
cyclobutanol;(4S)-3,3,4-trimethylpiperidine (PubChem CID 171847210) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is cyclobutanol;(4S)-3,3,4-trimethylpiperidine.
Molecular Properties
| Compound Name | cyclobutanol;(4S)-3,3,4-trimethylpiperidine |
| PubChem CID | 171847210 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | cyclobutanol;(4S)-3,3,4-trimethylpiperidine |
| SMILES | C[C@H]1CCNCC1(C)C.OC1CCC1 |
| InChI | InChI=1S/C8H17N.C4H8O/c1-7-4-5-9-6-8(7,2)3;5-4-2-1-3-4/h7,9H,4-6H2,1-3H3;4-5H,1-3H2/t7-;/m0./s1 |
| InChIKey | VXYZPPFHIGTBCX-FJXQXJEOSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutanol;(4S)-3,3,4-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanol;(4S)-3,3,4-trimethylpiperidine?
The IUPAC name of cyclobutanol;(4S)-3,3,4-trimethylpiperidine (CID 171847210) is cyclobutanol;(4S)-3,3,4-trimethylpiperidine.
What is the SMILES notation for cyclobutanol;(4S)-3,3,4-trimethylpiperidine?
The canonical SMILES for cyclobutanol;(4S)-3,3,4-trimethylpiperidine is C[C@H]1CCNCC1(C)C.OC1CCC1.
What is the InChIKey of cyclobutanol;(4S)-3,3,4-trimethylpiperidine?
The InChIKey is VXYZPPFHIGTBCX-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H17N.C4H8O/c1-7-4-5-9-6-8(7,2)3;5-4-2-1-3-4/h7,9H,4-6H2,1-3H3;4-5H,1-3H2/t7-;/m0./s1.
What are the key properties of cyclobutanol;(4S)-3,3,4-trimethylpiperidine?
cyclobutanol;(4S)-3,3,4-trimethylpiperidine has a molecular weight of 199.34 g/mol, XLogP of 2.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanol;(4S)-3,3,4-trimethylpiperidine is sourced from PubChem (CID 171847210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).