C25H21FN7NbO6PS — CID 171848410
[4-[4-[3-cyano-4-(2-cyano-4-fluorophenyl)sulfanylpyrazolo[1,5-a]pyridin-6-yl]-5-methylpyrazol-1-yl]cyclohexyl] nitro hydrogen phosphate;niobium (PubChem CID 171848410) has the molecular formula C25H21FN7NbO6PS and a molecular weight of 690.43 g/mol. Its IUPAC name is [4-[4-[3-cyano-4-(2-cyano-4-fluorophenyl)sulfanylpyrazolo[1,5-a]pyridin-6-yl]-5-methylpyrazol-1-yl]cyclohexyl] nitro hydrogen phosphate;niobium.
| Compound Name | [4-[4-[3-cyano-4-(2-cyano-4-fluorophenyl)sulfanylpyrazolo[1,5-a]pyridin-6-yl]-5-methylpyrazol-1-yl]cyclohexyl] nitro hydrogen phosphate;niobium |
|---|---|
| PubChem CID | 171848410 |
| Molecular Formula | C25H21FN7NbO6PS |
| Molecular Weight | 690.43 g/mol |
| Exact Mass | 690.01 |
| IUPAC Name | [4-[4-[3-cyano-4-(2-cyano-4-fluorophenyl)sulfanylpyrazolo[1,5-a]pyridin-6-yl]-5-methylpyrazol-1-yl]cyclohexyl] nitro hydrogen phosphate;niobium |
| SMILES | Cc1c(-c2cc(Sc3ccc(F)cc3C#N)c3c(C#N)cnn3c2)cnn1C1CCC(OP(=O)(O)O[N+](=O)[O-])CC1.[Nb] |
| InChI | InChI=1S/C25H21FN7O6PS.Nb/c1-15-22(13-30-32(15)20-3-5-21(6-4-20)38-40(36,37)39-33(34)35)17-9-24(25-18(11-28)12-29-31(25)14-17)41-23-7-2-19(26)8-16(23)10-27;/h2,7-9,12-14,20-21H,3-6H2,1H3,(H,36,37); |
| InChIKey | JRFFYUINXRAKPE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 181.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|