C20H20Cl2F3NO5 — CID 171848705
4-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-2,2,6,6-tetramethyloxane-4-carboxylic acid (PubChem CID 171848705) has the molecular formula C20H20Cl2F3NO5 and a molecular weight of 482.28 g/mol. Its IUPAC name is 4-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-2,2,6,6-tetramethyloxane-4-carboxylic acid.
| Compound Name | 4-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-2,2,6,6-tetramethyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 171848705 |
| Molecular Formula | C20H20Cl2F3NO5 |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 4-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-2,2,6,6-tetramethyloxane-4-carboxylic acid |
| SMILES | C#CC(=O)N(c1cc(Cl)c(OC(F)(F)F)c(Cl)c1)C1(C(=O)O)CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C20H20Cl2F3NO5/c1-6-14(27)26(11-7-12(21)15(13(22)8-11)30-20(23,24)25)19(16(28)29)9-17(2,3)31-18(4,5)10-19/h1,7-8H,9-10H2,2-5H3,(H,28,29) |
| InChIKey | BVFGNLLGDHQKQF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|