C19H19ClF3NO4 — CID 171848728
1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3-methylcyclohexane-1-carboxylic acid (PubChem CID 171848728) has the molecular formula C19H19ClF3NO4 and a molecular weight of 417.81 g/mol. Its IUPAC name is 1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171848728 |
| Molecular Formula | C19H19ClF3NO4 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3-methylcyclohexane-1-carboxylic acid |
| SMILES | C#CC(=O)N(c1ccc(OCC(F)(F)F)c(Cl)c1)C1(C(=O)O)CCCC(C)C1 |
| InChI | InChI=1S/C19H19ClF3NO4/c1-3-16(25)24(18(17(26)27)8-4-5-12(2)10-18)13-6-7-15(14(20)9-13)28-11-19(21,22)23/h1,6-7,9,12H,4-5,8,10-11H2,2H3,(H,26,27) |
| InChIKey | WTQPGXOLNYFKBB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|