C12H16ClNO — CID 171849066
3-chloro-4-cyclobutyloxy-N,5-dimethylaniline (PubChem CID 171849066) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 3-chloro-4-cyclobutyloxy-N,5-dimethylaniline.
| Compound Name | 3-chloro-4-cyclobutyloxy-N,5-dimethylaniline |
|---|---|
| PubChem CID | 171849066 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-chloro-4-cyclobutyloxy-N,5-dimethylaniline |
| SMILES | CNc1cc(C)c(OC2CCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO/c1-8-6-9(14-2)7-11(13)12(8)15-10-4-3-5-10/h6-7,10,14H,3-5H2,1-2H3 |
| InChIKey | YJYMAXCSKMMUEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|