C17H12O2S — CID 171849185
4-ethyl-10-hydroxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one (PubChem CID 171849185) has the molecular formula C17H12O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-ethyl-10-hydroxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one.
| Compound Name | 4-ethyl-10-hydroxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one |
|---|---|
| PubChem CID | 171849185 |
| Molecular Formula | C17H12O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-ethyl-10-hydroxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one |
| SMILES | CCc1ccc2cc3c(O)ccc4c3c(c2c1)SC4=O |
| InChI | InChI=1S/C17H12O2S/c1-2-9-3-4-10-8-13-14(18)6-5-11-15(13)16(12(10)7-9)20-17(11)19/h3-8,18H,2H2,1H3 |
| InChIKey | FXFOVTZGEFRYJC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|