C24H29F2N5O2 — CID 171849711
ethyl (6R)-6-[4-[5-fluoro-3-(2-fluoro-3-pyridinyl)-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate (PubChem CID 171849711) has the molecular formula C24H29F2N5O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl (6R)-6-[4-[5-fluoro-3-(2-fluoro-3-pyridinyl)-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate.
| Compound Name | ethyl (6R)-6-[4-[5-fluoro-3-(2-fluoro-3-pyridinyl)-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 171849711 |
| Molecular Formula | C24H29F2N5O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | ethyl (6R)-6-[4-[5-fluoro-3-(2-fluoro-3-pyridinyl)-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate |
| SMILES | CCOC(=O)N1CC2(CC[C@@H](N3CCN(c4ncc(F)cc4-c4cccnc4F)CC3)C2)C1 |
| InChI | InChI=1S/C24H29F2N5O2/c1-2-33-23(32)31-15-24(16-31)6-5-18(13-24)29-8-10-30(11-9-29)22-20(12-17(25)14-28-22)19-4-3-7-27-21(19)26/h3-4,7,12,14,18H,2,5-6,8-11,13,15-16H2,1H3/t18-/m1/s1 |
| InChIKey | HXNXUCQXTPQEAQ-GOSISDBHSA-N |
| XLogP | 3.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|