C19H29BN4O4 — CID 171850088
[2-[4-[(6R)-2-ethoxycarbonyl-2-azaspiro[3.4]octan-6-yl]piperazin-1-yl]-3-pyridinyl]boronic acid (PubChem CID 171850088) has the molecular formula C19H29BN4O4 and a molecular weight of 388.28 g/mol. Its IUPAC name is [2-[4-[(6R)-2-ethoxycarbonyl-2-azaspiro[3.4]octan-6-yl]piperazin-1-yl]-3-pyridinyl]boronic acid.
| Compound Name | [2-[4-[(6R)-2-ethoxycarbonyl-2-azaspiro[3.4]octan-6-yl]piperazin-1-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 171850088 |
| Molecular Formula | C19H29BN4O4 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [2-[4-[(6R)-2-ethoxycarbonyl-2-azaspiro[3.4]octan-6-yl]piperazin-1-yl]-3-pyridinyl]boronic acid |
| SMILES | CCOC(=O)N1CC2(CC[C@@H](N3CCN(c4ncccc4B(O)O)CC3)C2)C1 |
| InChI | InChI=1S/C19H29BN4O4/c1-2-28-18(25)24-13-19(14-24)6-5-15(12-19)22-8-10-23(11-9-22)17-16(20(26)27)4-3-7-21-17/h3-4,7,15,26-27H,2,5-6,8-14H2,1H3/t15-/m1/s1 |
| InChIKey | BEAYFXBRTZXUNS-OAHLLOKOSA-N |
| XLogP | -0.11 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|