C19H29N5O5 — CID 171850387
(4S)-4-amino-5-[[(2S)-1-[[(2S)-1-(4-aminoanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 171850387) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (4S)-4-amino-5-[[(2S)-1-[[(2S)-1-(4-aminoanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[(2S)-1-[[(2S)-1-(4-aminoanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 171850387 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-1-[[(2S)-1-(4-aminoanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](C)C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C19H29N5O5/c1-10(2)16(24-18(28)14(21)8-9-15(25)26)19(29)22-11(3)17(27)23-13-6-4-12(20)5-7-13/h4-7,10-11,14,16H,8-9,20-21H2,1-3H3,(H,22,29)(H,23,27)(H,24,28)(H,25,26)/t11-,14-,16-/m0/s1 |
| InChIKey | FNNOROIHBINQIF-PJODQICGSA-N |
| XLogP | 0.04 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|