C21H27ClN6O — CID 171850981
2-N-(4-ethoxyphenyl)-1-phenyl-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 171850981) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is 2-N-(4-ethoxyphenyl)-1-phenyl-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-(4-ethoxyphenyl)-1-phenyl-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171850981 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-N-(4-ethoxyphenyl)-1-phenyl-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | CCOc1ccc(NC2N=C(N)N=C(N3CCCC3)N2c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C21H26N6O.ClH/c1-2-28-18-12-10-16(11-13-18)23-20-24-19(22)25-21(26-14-6-7-15-26)27(20)17-8-4-3-5-9-17;/h3-5,8-13,20,23H,2,6-7,14-15H2,1H3,(H2,22,24);1H |
| InChIKey | VOJWSDMWEZMVEM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|