C20H23ClN6O2 — CID 171851398
2-N-(3-chloro-4-methoxyphenyl)-6-morpholin-4-yl-1-phenyl-2H-1,3,5-triazine-2,4-diamine (PubChem CID 171851398) has the molecular formula C20H23ClN6O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is 2-N-(3-chloro-4-methoxyphenyl)-6-morpholin-4-yl-1-phenyl-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-methoxyphenyl)-6-morpholin-4-yl-1-phenyl-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171851398 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-N-(3-chloro-4-methoxyphenyl)-6-morpholin-4-yl-1-phenyl-2H-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(NC2N=C(N)N=C(N3CCOCC3)N2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H23ClN6O2/c1-28-17-8-7-14(13-16(17)21)23-19-24-18(22)25-20(26-9-11-29-12-10-26)27(19)15-5-3-2-4-6-15/h2-8,13,19,23H,9-12H2,1H3,(H2,22,24) |
| InChIKey | HVSWLJCFGSLGFO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|