C21H25ClN6O2 — CID 171851458
2-N-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 171851458) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171851458 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(N2C(N3CCCC3)=NC(N)=NC2Nc2ccc3c(c2)OCO3)cc1.Cl |
| InChI | InChI=1S/C21H24N6O2.ClH/c1-14-4-7-16(8-5-14)27-20(23-15-6-9-17-18(12-15)29-13-28-17)24-19(22)25-21(27)26-10-2-3-11-26;/h4-9,12,20,23H,2-3,10-11,13H2,1H3,(H2,22,24);1H |
| InChIKey | CUKDPKSFDUNUCQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|