About tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate
tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate (PubChem CID 171852979) has the molecular formula C14H29N3O4
and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate |
| PubChem CID | 171852979 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCN(C[C@@H](O)CO)CC1 |
| InChI | InChI=1S/C14H29N3O4/c1-14(2,3)21-13(20)15-4-5-16-6-8-17(9-7-16)10-12(19)11-18/h12,18-19H,4-11H2,1-3H3,(H,15,20)/t12-/m1/s1 |
| InChIKey | YGGCNROTAFFGCN-GFCCVEGCSA-N |
| XLogP | -0.52 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate (CID 171852979) is tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate is CC(C)(C)OC(=O)NCCN1CCN(C[C@@H](O)CO)CC1.
What is the InChIKey of tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate?
The InChIKey is YGGCNROTAFFGCN-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H29N3O4/c1-14(2,3)21-13(20)15-4-5-16-6-8-17(9-7-16)10-12(19)11-18/h12,18-19H,4-11H2,1-3H3,(H,15,20)/t12-/m1/s1.
What are the key properties of tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate?
tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate has a molecular weight of 303.40 g/mol, XLogP of -0.52, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-[(2R)-2,3-dihydroxypropyl]piperazin-1-yl]ethyl]carbamate is sourced from PubChem (CID 171852979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).