C15H10N4O — CID 171853619
2,10,13,16-tetrazatetracyclo[9.8.0.02,8.014,19]nonadeca-1(19),3,5,7,10,12,14,16-octaen-9-one (PubChem CID 171853619) has the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. Its IUPAC name is 2,10,13,16-tetrazatetracyclo[9.8.0.02,8.014,19]nonadeca-1(19),3,5,7,10,12,14,16-octaen-9-one.
| Compound Name | 2,10,13,16-tetrazatetracyclo[9.8.0.02,8.014,19]nonadeca-1(19),3,5,7,10,12,14,16-octaen-9-one |
|---|---|
| PubChem CID | 171853619 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2,10,13,16-tetrazatetracyclo[9.8.0.02,8.014,19]nonadeca-1(19),3,5,7,10,12,14,16-octaen-9-one |
| SMILES | O=c1nc2cnc3c(c2n2c1=CC=CC=C2)CC=NC=3 |
| InChI | InChI=1S/C15H10N4O/c20-15-13-4-2-1-3-7-19(13)14-10-5-6-16-8-11(10)17-9-12(14)18-15/h1-4,6-9H,5H2 |
| InChIKey | KBGQOPBTQNOTLJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |