C28H39F2N5O2Si — CID 171853968
(4,4-difluoropiperidin-1-yl)-[4-[4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-(1-propan-2-ylpyrazol-3-yl)phenyl]methanone (PubChem CID 171853968) has the molecular formula C28H39F2N5O2Si and a molecular weight of 543.74 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-[4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-(1-propan-2-ylpyrazol-3-yl)phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-[4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-(1-propan-2-ylpyrazol-3-yl)phenyl]methanone |
|---|---|
| PubChem CID | 171853968 |
| Molecular Formula | C28H39F2N5O2Si |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-[4-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-(1-propan-2-ylpyrazol-3-yl)phenyl]methanone |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c(-c2ccc(C(=O)N3CCC(F)(F)CC3)c(-c3ccn(C(C)C)n3)c2)n1 |
| InChI | InChI=1S/C28H39F2N5O2Si/c1-20(2)35-12-9-25(32-35)24-17-22(7-8-23(24)27(36)33-13-10-28(29,30)11-14-33)26-31-21(3)18-34(26)19-37-15-16-38(4,5)6/h7-9,12,17-18,20H,10-11,13-16,19H2,1-6H3 |
| InChIKey | LWMAIJLWOJTMRJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|