C12H11Cl2FN4S — CID 171854168
3-[1-(2,6-dichloro-4-pyridinyl)-3-fluorocyclobutyl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 171854168) has the molecular formula C12H11Cl2FN4S and a molecular weight of 333.22 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-4-pyridinyl)-3-fluorocyclobutyl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[1-(2,6-dichloro-4-pyridinyl)-3-fluorocyclobutyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 171854168 |
| Molecular Formula | C12H11Cl2FN4S |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3-[1-(2,6-dichloro-4-pyridinyl)-3-fluorocyclobutyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(C2(c3cc(Cl)nc(Cl)c3)CC(F)C2)n[nH]c1=S |
| InChI | InChI=1S/C12H11Cl2FN4S/c1-19-10(17-18-11(19)20)12(4-7(15)5-12)6-2-8(13)16-9(14)3-6/h2-3,7H,4-5H2,1H3,(H,18,20) |
| InChIKey | USKNOZQXXMACHD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|