C21H21NO2 — CID 171854726
tert-butyl 4-(4-ethynylphenyl)-1,3-dihydroisoindole-2-carboxylate (PubChem CID 171854726) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 4-(4-ethynylphenyl)-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 4-(4-ethynylphenyl)-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 171854726 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | tert-butyl 4-(4-ethynylphenyl)-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C#Cc1ccc(-c2cccc3c2CN(C(=O)OC(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C21H21NO2/c1-5-15-9-11-16(12-10-15)18-8-6-7-17-13-22(14-19(17)18)20(23)24-21(2,3)4/h1,6-12H,13-14H2,2-4H3 |
| InChIKey | PPYFNTLRQXRNCO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|