C10H15N3 — CID 171854974
1,2,3,4,4a,5,6,8-octahydropyrimido[4,5-g]indolizine (PubChem CID 171854974) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,8-octahydropyrimido[4,5-g]indolizine.
| Compound Name | 1,2,3,4,4a,5,6,8-octahydropyrimido[4,5-g]indolizine |
|---|---|
| PubChem CID | 171854974 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,8-octahydropyrimido[4,5-g]indolizine |
| SMILES | C1=CC2=C3CNCNC3CCN2C1 |
| InChI | InChI=1S/C10H15N3/c1-2-10-8-6-11-7-12-9(8)3-5-13(10)4-1/h1-2,9,11-12H,3-7H2 |
| InChIKey | RNAZNDXTWILYFJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |