C14H12N2O2S — CID 171855025
1,4-dimethyl-5-[(5-methylthiophen-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 171855025) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 1,4-dimethyl-5-[(5-methylthiophen-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-5-[(5-methylthiophen-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171855025 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1,4-dimethyl-5-[(5-methylthiophen-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)C1=Cc1ccc(C)s1 |
| InChI | InChI=1S/C14H12N2O2S/c1-8-4-5-10(19-8)6-11-9(2)12(7-15)14(18)16(3)13(11)17/h4-6H,1-3H3 |
| InChIKey | KSCMFNLIUJXGQW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|