C14H20O5 — CID 171855026
(3Z)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,15-triene (PubChem CID 171855026) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (3Z)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,15-triene.
| Compound Name | (3Z)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,15-triene |
|---|---|
| PubChem CID | 171855026 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (3Z)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,15-triene |
| SMILES | C1=C2O/C=C\OCCOCCOCCOC2=CCC1 |
| InChI | InChI=1S/C14H20O5/c1-2-4-14-13(3-1)18-11-9-16-7-5-15-6-8-17-10-12-19-14/h3-4,9,11H,1-2,5-8,10,12H2/b11-9- |
| InChIKey | PKWDVHLAUIMTKH-LUAWRHEFSA-N |
| XLogP | 2.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |