About 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine
2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine (PubChem CID 171855258) has the molecular formula C10H11N7O4S
and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine.
Molecular Properties
| Compound Name | 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine |
| PubChem CID | 171855258 |
| Molecular Formula | C10H11N7O4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(/N=N/C2C(=O)NNC2=O)cc1 |
| InChI | InChI=1S/C10H11N7O4S/c11-10(12)17-22(20,21)6-3-1-5(2-4-6)13-14-7-8(18)15-16-9(7)19/h1-4,7H,(H,15,18)(H,16,19)(H4,11,12,17)/b14-13+ |
| InChIKey | DMQBJRUKKMQNRK-BUHFOSPRSA-N |
| XLogP | -1.74 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine?
The IUPAC name of 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine (CID 171855258) is 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine.
What is the SMILES notation for 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine?
The canonical SMILES for 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine is NC(N)=NS(=O)(=O)c1ccc(/N=N/C2C(=O)NNC2=O)cc1.
What is the InChIKey of 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine?
The InChIKey is DMQBJRUKKMQNRK-BUHFOSPRSA-N. The full InChI is InChI=1S/C10H11N7O4S/c11-10(12)17-22(20,21)6-3-1-5(2-4-6)13-14-7-8(18)15-16-9(7)19/h1-4,7H,(H,15,18)(H,16,19)(H4,11,12,17)/b14-13+.
What are the key properties of 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine?
2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine has a molecular weight of 325.31 g/mol, XLogP of -1.74, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]sulfonylguanidine is sourced from PubChem (CID 171855258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).