C10H12BN3O4 — CID 171855297
(2-ethoxycarbonyl-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid (PubChem CID 171855297) has the molecular formula C10H12BN3O4 and a molecular weight of 249.03 g/mol. Its IUPAC name is (2-ethoxycarbonyl-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid.
| Compound Name | (2-ethoxycarbonyl-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid |
|---|---|
| PubChem CID | 171855297 |
| Molecular Formula | C10H12BN3O4 |
| Molecular Weight | 249.03 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (2-ethoxycarbonyl-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid |
| SMILES | CCOC(=O)c1nc2cc(C)cc(B(O)O)n2n1 |
| InChI | InChI=1S/C10H12BN3O4/c1-3-18-10(15)9-12-8-5-6(2)4-7(11(16)17)14(8)13-9/h4-5,16-17H,3H2,1-2H3 |
| InChIKey | NMYQWTNQLHKJFD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.03 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|