About 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol
1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol (PubChem CID 171858182) has the molecular formula C10H13ClN4O2
and a molecular weight of 256.69 g/mol. Its IUPAC name is 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol |
| PubChem CID | 171858182 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1cnn2ccc(Cl)nc12 |
| InChI | InChI=1S/C10H13ClN4O2/c1-12-5-7(16)9(17)6-4-13-15-3-2-8(11)14-10(6)15/h2-4,7,9,12,16-17H,5H2,1H3 |
| InChIKey | JVPXHMHNAIXKBK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol?
The IUPAC name of 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol (CID 171858182) is 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol.
What is the SMILES notation for 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol?
The canonical SMILES for 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol is CNCC(O)C(O)c1cnn2ccc(Cl)nc12.
What is the InChIKey of 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol?
The InChIKey is JVPXHMHNAIXKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4O2/c1-12-5-7(16)9(17)6-4-13-15-3-2-8(11)14-10(6)15/h2-4,7,9,12,16-17H,5H2,1H3.
What are the key properties of 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol?
1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol has a molecular weight of 256.69 g/mol, XLogP of -0.00, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)-3-(methylamino)propane-1,2-diol is sourced from PubChem (CID 171858182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).