About methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate
methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate (PubChem CID 171858616) has the molecular formula C12H18N2O4
and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate |
| PubChem CID | 171858616 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate |
| SMILES | CNCC(O)C(O)c1cnc(C(=O)OC)c(C)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-7-4-8(11(16)9(15)6-13-2)5-14-10(7)12(17)18-3/h4-5,9,11,13,15-16H,6H2,1-3H3 |
| InChIKey | MMAIEYSBOCYKHK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate?
The IUPAC name of methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate (CID 171858616) is methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate.
What is the SMILES notation for methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate?
The canonical SMILES for methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate is CNCC(O)C(O)c1cnc(C(=O)OC)c(C)c1.
What is the InChIKey of methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate?
The InChIKey is MMAIEYSBOCYKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-7-4-8(11(16)9(15)6-13-2)5-14-10(7)12(17)18-3/h4-5,9,11,13,15-16H,6H2,1-3H3.
What are the key properties of methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate?
methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate has a molecular weight of 254.29 g/mol, XLogP of -0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1,2-dihydroxy-3-(methylamino)propyl]-3-methylpyridine-2-carboxylate is sourced from PubChem (CID 171858616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).