C15H25NO4 — CID 171859140
1-[4-(diethoxymethyl)phenyl]-3-(methylamino)propane-1,2-diol (PubChem CID 171859140) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[4-(diethoxymethyl)phenyl]-3-(methylamino)propane-1,2-diol.
| Compound Name | 1-[4-(diethoxymethyl)phenyl]-3-(methylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 171859140 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-[4-(diethoxymethyl)phenyl]-3-(methylamino)propane-1,2-diol |
| SMILES | CCOC(OCC)c1ccc(C(O)C(O)CNC)cc1 |
| InChI | InChI=1S/C15H25NO4/c1-4-19-15(20-5-2)12-8-6-11(7-9-12)14(18)13(17)10-16-3/h6-9,13-18H,4-5,10H2,1-3H3 |
| InChIKey | MJXHOOPKYQCKQD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|