About 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol
1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol (PubChem CID 171859277) has the molecular formula C7H11BrN2O2S
and a molecular weight of 267.15 g/mol. Its IUPAC name is 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol |
| PubChem CID | 171859277 |
| Molecular Formula | C7H11BrN2O2S |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1csc(Br)n1 |
| InChI | InChI=1S/C7H11BrN2O2S/c1-9-2-5(11)6(12)4-3-13-7(8)10-4/h3,5-6,9,11-12H,2H2,1H3 |
| InChIKey | LJYPQYUHCJWRLF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol?
The IUPAC name of 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol (CID 171859277) is 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol.
What is the SMILES notation for 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol?
The canonical SMILES for 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol is CNCC(O)C(O)c1csc(Br)n1.
What is the InChIKey of 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol?
The InChIKey is LJYPQYUHCJWRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrN2O2S/c1-9-2-5(11)6(12)4-3-13-7(8)10-4/h3,5-6,9,11-12H,2H2,1H3.
What are the key properties of 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol?
1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol has a molecular weight of 267.15 g/mol, XLogP of 0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-1,3-thiazol-4-yl)-3-(methylamino)propane-1,2-diol is sourced from PubChem (CID 171859277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).